C15H16N2O2 — CID 55201043
4-(3-benzyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-one (PubChem CID 55201043) has the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. Its IUPAC name is 4-(3-benzyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-one.
| Compound Name | 4-(3-benzyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-one |
|---|---|
| PubChem CID | 55201043 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 4-(3-benzyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-one |
| SMILES | O=C1CCC(c2nc(Cc3ccccc3)no2)CC1 |
| InChI | InChI=1S/C15H16N2O2/c18-13-8-6-12(7-9-13)15-16-14(17-19-15)10-11-4-2-1-3-5-11/h1-5,12H,6-10H2 |
| InChIKey | IXAHVMUNFJCJGQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |