C15H20N2O2 — CID 55201689
1-[5-methyl-2-(1,2-oxazol-5-ylmethoxy)phenyl]butan-2-amine (PubChem CID 55201689) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 1-[5-methyl-2-(1,2-oxazol-5-ylmethoxy)phenyl]butan-2-amine.
| Compound Name | 1-[5-methyl-2-(1,2-oxazol-5-ylmethoxy)phenyl]butan-2-amine |
|---|---|
| PubChem CID | 55201689 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 1-[5-methyl-2-(1,2-oxazol-5-ylmethoxy)phenyl]butan-2-amine |
| SMILES | CCC(N)Cc1cc(C)ccc1OCc1ccno1 |
| InChI | InChI=1S/C15H20N2O2/c1-3-13(16)9-12-8-11(2)4-5-15(12)18-10-14-6-7-17-19-14/h4-8,13H,3,9-10,16H2,1-2H3 |
| InChIKey | HOJZDAYMBIEVBP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |