C10H9N3O3S — CID 55206367
3-[(2-amino-5-nitrophenyl)methyl]-1,3-thiazol-2-one (PubChem CID 55206367) has the molecular formula C10H9N3O3S and a molecular weight of 251.27 g/mol. Its IUPAC name is 3-[(2-amino-5-nitrophenyl)methyl]-1,3-thiazol-2-one.
| Compound Name | 3-[(2-amino-5-nitrophenyl)methyl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 55206367 |
| Molecular Formula | C10H9N3O3S |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 3-[(2-amino-5-nitrophenyl)methyl]-1,3-thiazol-2-one |
| SMILES | Nc1ccc([N+](=O)[O-])cc1Cn1ccsc1=O |
| InChI | InChI=1S/C10H9N3O3S/c11-9-2-1-8(13(15)16)5-7(9)6-12-3-4-17-10(12)14/h1-5H,6,11H2 |
| InChIKey | XETSEVJBTLAMOK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|