C10H11N3OS — CID 55211755
4-(1-oxo-1,4-thiazinan-4-yl)pyridine-2-carbonitrile (PubChem CID 55211755) has the molecular formula C10H11N3OS and a molecular weight of 221.28 g/mol. Its IUPAC name is 4-(1-oxo-1,4-thiazinan-4-yl)pyridine-2-carbonitrile.
| Compound Name | 4-(1-oxo-1,4-thiazinan-4-yl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 55211755 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 4-(1-oxo-1,4-thiazinan-4-yl)pyridine-2-carbonitrile |
| SMILES | N#Cc1cc(N2CCS(=O)CC2)ccn1 |
| InChI | InChI=1S/C10H11N3OS/c11-8-9-7-10(1-2-12-9)13-3-5-15(14)6-4-13/h1-2,7H,3-6H2 |
| InChIKey | LGTBWPSWRGWAPP-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |