C15H22N2O2 — CID 55214976
4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)pentanehydrazide (PubChem CID 55214976) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)pentanehydrazide.
| Compound Name | 4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)pentanehydrazide |
|---|---|
| PubChem CID | 55214976 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)pentanehydrazide |
| SMILES | CC(CCC(=O)NN)Oc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C15H22N2O2/c1-11(6-9-15(18)17-16)19-14-8-7-12-4-2-3-5-13(12)10-14/h7-8,10-11H,2-6,9,16H2,1H3,(H,17,18) |
| InChIKey | VGJIVGOYMMZYKB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|