About [3-[(3,3,4-trimethylpiperazin-1-yl)methyl]oxolan-3-yl]methanamine
[3-[(3,3,4-trimethylpiperazin-1-yl)methyl]oxolan-3-yl]methanamine (PubChem CID 55217570) has the molecular formula C13H27N3O
and a molecular weight of 241.38 g/mol. Its IUPAC name is [3-[(3,3,4-trimethylpiperazin-1-yl)methyl]oxolan-3-yl]methanamine.
Molecular Properties
| Compound Name | [3-[(3,3,4-trimethylpiperazin-1-yl)methyl]oxolan-3-yl]methanamine |
| PubChem CID | 55217570 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | [3-[(3,3,4-trimethylpiperazin-1-yl)methyl]oxolan-3-yl]methanamine |
| SMILES | CN1CCN(CC2(CN)CCOC2)CC1(C)C |
| InChI | InChI=1S/C13H27N3O/c1-12(2)9-16(6-5-15(12)3)10-13(8-14)4-7-17-11-13/h4-11,14H2,1-3H3 |
| InChIKey | VABFCWRHKYPQME-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-[(3,3,4-trimethylpiperazin-1-yl)methyl]oxolan-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(3,3,4-trimethylpiperazin-1-yl)methyl]oxolan-3-yl]methanamine?
The IUPAC name of [3-[(3,3,4-trimethylpiperazin-1-yl)methyl]oxolan-3-yl]methanamine (CID 55217570) is [3-[(3,3,4-trimethylpiperazin-1-yl)methyl]oxolan-3-yl]methanamine.
What is the SMILES notation for [3-[(3,3,4-trimethylpiperazin-1-yl)methyl]oxolan-3-yl]methanamine?
The canonical SMILES for [3-[(3,3,4-trimethylpiperazin-1-yl)methyl]oxolan-3-yl]methanamine is CN1CCN(CC2(CN)CCOC2)CC1(C)C.
What is the InChIKey of [3-[(3,3,4-trimethylpiperazin-1-yl)methyl]oxolan-3-yl]methanamine?
The InChIKey is VABFCWRHKYPQME-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3O/c1-12(2)9-16(6-5-15(12)3)10-13(8-14)4-7-17-11-13/h4-11,14H2,1-3H3.
What are the key properties of [3-[(3,3,4-trimethylpiperazin-1-yl)methyl]oxolan-3-yl]methanamine?
[3-[(3,3,4-trimethylpiperazin-1-yl)methyl]oxolan-3-yl]methanamine has a molecular weight of 241.38 g/mol, XLogP of 0.38, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(3,3,4-trimethylpiperazin-1-yl)methyl]oxolan-3-yl]methanamine is sourced from PubChem (CID 55217570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).