C9H17N3O4S — CID 55218367
3-methyl-4-morpholin-4-ylsulfonylpiperazin-2-one (PubChem CID 55218367) has the molecular formula C9H17N3O4S and a molecular weight of 263.32 g/mol. Its IUPAC name is 3-methyl-4-morpholin-4-ylsulfonylpiperazin-2-one.
| Compound Name | 3-methyl-4-morpholin-4-ylsulfonylpiperazin-2-one |
|---|---|
| PubChem CID | 55218367 |
| Molecular Formula | C9H17N3O4S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 3-methyl-4-morpholin-4-ylsulfonylpiperazin-2-one |
| SMILES | CC1C(=O)NCCN1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C9H17N3O4S/c1-8-9(13)10-2-3-12(8)17(14,15)11-4-6-16-7-5-11/h8H,2-7H2,1H3,(H,10,13) |
| InChIKey | VXUOTQIVZFJLHK-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |