C8H17N3O3S — CID 63605941
3-methyl-4-[2-(methylamino)ethylsulfonyl]piperazin-2-one (PubChem CID 63605941) has the molecular formula C8H17N3O3S and a molecular weight of 235.31 g/mol. Its IUPAC name is 3-methyl-4-[2-(methylamino)ethylsulfonyl]piperazin-2-one.
| Compound Name | 3-methyl-4-[2-(methylamino)ethylsulfonyl]piperazin-2-one |
|---|---|
| PubChem CID | 63605941 |
| Molecular Formula | C8H17N3O3S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 3-methyl-4-[2-(methylamino)ethylsulfonyl]piperazin-2-one |
| SMILES | CNCCS(=O)(=O)N1CCNC(=O)C1C |
| InChI | InChI=1S/C8H17N3O3S/c1-7-8(12)10-3-5-11(7)15(13,14)6-4-9-2/h7,9H,3-6H2,1-2H3,(H,10,12) |
| InChIKey | ZLGMYFVCWRLOEZ-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |