C11H8N2OS — CID 55219191
4-[(2-oxo-1,3-thiazol-3-yl)methyl]benzonitrile (PubChem CID 55219191) has the molecular formula C11H8N2OS and a molecular weight of 216.26 g/mol. Its IUPAC name is 4-[(2-oxo-1,3-thiazol-3-yl)methyl]benzonitrile.
| Compound Name | 4-[(2-oxo-1,3-thiazol-3-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 55219191 |
| Molecular Formula | C11H8N2OS |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 4-[(2-oxo-1,3-thiazol-3-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccc(Cn2ccsc2=O)cc1 |
| InChI | InChI=1S/C11H8N2OS/c12-7-9-1-3-10(4-2-9)8-13-5-6-15-11(13)14/h1-6H,8H2 |
| InChIKey | LPKUNBXVMMUZAG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |