C16H15BrF2 — CID 55219697
1-[1-bromo-2-(2,5-dimethylphenyl)ethyl]-2,4-difluorobenzene (PubChem CID 55219697) has the molecular formula C16H15BrF2 and a molecular weight of 325.20 g/mol. Its IUPAC name is 1-[1-bromo-2-(2,5-dimethylphenyl)ethyl]-2,4-difluorobenzene.
| Compound Name | 1-[1-bromo-2-(2,5-dimethylphenyl)ethyl]-2,4-difluorobenzene |
|---|---|
| PubChem CID | 55219697 |
| Molecular Formula | C16H15BrF2 |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 1-[1-bromo-2-(2,5-dimethylphenyl)ethyl]-2,4-difluorobenzene |
| SMILES | Cc1ccc(C)c(CC(Br)c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C16H15BrF2/c1-10-3-4-11(2)12(7-10)8-15(17)14-6-5-13(18)9-16(14)19/h3-7,9,15H,8H2,1-2H3 |
| InChIKey | ADNBNUJVPZPBOQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|