C16H15ClF2 — CID 63544773
1-[1-chloro-2-(2,5-dimethylphenyl)ethyl]-2,3-difluorobenzene (PubChem CID 63544773) has the molecular formula C16H15ClF2 and a molecular weight of 280.75 g/mol. Its IUPAC name is 1-[1-chloro-2-(2,5-dimethylphenyl)ethyl]-2,3-difluorobenzene.
| Compound Name | 1-[1-chloro-2-(2,5-dimethylphenyl)ethyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 63544773 |
| Molecular Formula | C16H15ClF2 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 1-[1-chloro-2-(2,5-dimethylphenyl)ethyl]-2,3-difluorobenzene |
| SMILES | Cc1ccc(C)c(CC(Cl)c2cccc(F)c2F)c1 |
| InChI | InChI=1S/C16H15ClF2/c1-10-6-7-11(2)12(8-10)9-14(17)13-4-3-5-15(18)16(13)19/h3-8,14H,9H2,1-2H3 |
| InChIKey | NGTABHIHHMCERX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|