C16H16BrCl — CID 55224263
2-[2-(2-bromophenyl)-2-chloroethyl]-1,4-dimethylbenzene (PubChem CID 55224263) has the molecular formula C16H16BrCl and a molecular weight of 323.66 g/mol. Its IUPAC name is 2-[2-(2-bromophenyl)-2-chloroethyl]-1,4-dimethylbenzene.
| Compound Name | 2-[2-(2-bromophenyl)-2-chloroethyl]-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 55224263 |
| Molecular Formula | C16H16BrCl |
| Molecular Weight | 323.66 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 2-[2-(2-bromophenyl)-2-chloroethyl]-1,4-dimethylbenzene |
| SMILES | Cc1ccc(C)c(CC(Cl)c2ccccc2Br)c1 |
| InChI | InChI=1S/C16H16BrCl/c1-11-7-8-12(2)13(9-11)10-16(18)14-5-3-4-6-15(14)17/h3-9,16H,10H2,1-2H3 |
| InChIKey | NUFMFGRQUUXQCQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.66 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|