C11H8ClN3S — CID 55219904
4-chloro-2-[(4-methyl-1,3-thiazol-2-yl)amino]benzonitrile (PubChem CID 55219904) has the molecular formula C11H8ClN3S and a molecular weight of 249.73 g/mol. Its IUPAC name is 4-chloro-2-[(4-methyl-1,3-thiazol-2-yl)amino]benzonitrile.
| Compound Name | 4-chloro-2-[(4-methyl-1,3-thiazol-2-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 55219904 |
| Molecular Formula | C11H8ClN3S |
| Molecular Weight | 249.73 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 4-chloro-2-[(4-methyl-1,3-thiazol-2-yl)amino]benzonitrile |
| SMILES | Cc1csc(Nc2cc(Cl)ccc2C#N)n1 |
| InChI | InChI=1S/C11H8ClN3S/c1-7-6-16-11(14-7)15-10-4-9(12)3-2-8(10)5-13/h2-4,6H,1H3,(H,14,15) |
| InChIKey | LUHDRVJSTVFGEA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.73 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |