C13H10Cl2N4 — CID 80935656
4-chloro-2-[(6-chloro-2-ethylpyrimidin-4-yl)amino]benzonitrile (PubChem CID 80935656) has the molecular formula C13H10Cl2N4 and a molecular weight of 293.16 g/mol. Its IUPAC name is 4-chloro-2-[(6-chloro-2-ethylpyrimidin-4-yl)amino]benzonitrile.
| Compound Name | 4-chloro-2-[(6-chloro-2-ethylpyrimidin-4-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 80935656 |
| Molecular Formula | C13H10Cl2N4 |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 4-chloro-2-[(6-chloro-2-ethylpyrimidin-4-yl)amino]benzonitrile |
| SMILES | CCc1nc(Cl)cc(Nc2cc(Cl)ccc2C#N)n1 |
| InChI | InChI=1S/C13H10Cl2N4/c1-2-12-18-11(15)6-13(19-12)17-10-5-9(14)4-3-8(10)7-16/h3-6H,2H2,1H3,(H,17,18,19) |
| InChIKey | MLGQPIOZOYUBMR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |