C11H11ClN6 — CID 108775345
5-[(6-chloro-2-ethylpyrimidin-4-yl)amino]-1-methylpyrazole-4-carbonitrile (PubChem CID 108775345) has the molecular formula C11H11ClN6 and a molecular weight of 262.70 g/mol. Its IUPAC name is 5-[(6-chloro-2-ethylpyrimidin-4-yl)amino]-1-methylpyrazole-4-carbonitrile.
| Compound Name | 5-[(6-chloro-2-ethylpyrimidin-4-yl)amino]-1-methylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 108775345 |
| Molecular Formula | C11H11ClN6 |
| Molecular Weight | 262.70 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 5-[(6-chloro-2-ethylpyrimidin-4-yl)amino]-1-methylpyrazole-4-carbonitrile |
| SMILES | CCc1nc(Cl)cc(Nc2c(C#N)cnn2C)n1 |
| InChI | InChI=1S/C11H11ClN6/c1-3-9-15-8(12)4-10(16-9)17-11-7(5-13)6-14-18(11)2/h4,6H,3H2,1-2H3,(H,15,16,17) |
| InChIKey | VYQMWEYLPZYMMA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.70 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |