C11H22N4O2 — CID 55222178
2-(4-acetylpiperazin-1-yl)-N'-hydroxypentanimidamide (PubChem CID 55222178) has the molecular formula C11H22N4O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-(4-acetylpiperazin-1-yl)-N'-hydroxypentanimidamide.
| Compound Name | 2-(4-acetylpiperazin-1-yl)-N'-hydroxypentanimidamide |
|---|---|
| PubChem CID | 55222178 |
| Molecular Formula | C11H22N4O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 2-(4-acetylpiperazin-1-yl)-N'-hydroxypentanimidamide |
| SMILES | CCCC(/C(N)=N/O)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C11H22N4O2/c1-3-4-10(11(12)13-17)15-7-5-14(6-8-15)9(2)16/h10,17H,3-8H2,1-2H3,(H2,12,13) |
| InChIKey | TZIRWHFEANFSRN-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|