C12H24N4O3 — CID 77012839
N'-hydroxy-2-[4-(2-methoxyacetyl)piperazin-1-yl]pentanimidamide (PubChem CID 77012839) has the molecular formula C12H24N4O3 and a molecular weight of 272.35 g/mol. Its IUPAC name is N'-hydroxy-2-[4-(2-methoxyacetyl)piperazin-1-yl]pentanimidamide.
| Compound Name | N'-hydroxy-2-[4-(2-methoxyacetyl)piperazin-1-yl]pentanimidamide |
|---|---|
| PubChem CID | 77012839 |
| Molecular Formula | C12H24N4O3 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | N'-hydroxy-2-[4-(2-methoxyacetyl)piperazin-1-yl]pentanimidamide |
| SMILES | CCCC(C(N)=NO)N1CCN(C(=O)COC)CC1 |
| InChI | InChI=1S/C12H24N4O3/c1-3-4-10(12(13)14-18)15-5-7-16(8-6-15)11(17)9-19-2/h10,18H,3-9H2,1-2H3,(H2,13,14) |
| InChIKey | OAKWFRCLPCUZSU-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|