C16H29ClN2 — CID 55223281
4-(1-chloropropyl)-1-(2-ethylhexyl)-3,5-dimethylpyrazole (PubChem CID 55223281) has the molecular formula C16H29ClN2 and a molecular weight of 284.88 g/mol. Its IUPAC name is 4-(1-chloropropyl)-1-(2-ethylhexyl)-3,5-dimethylpyrazole.
| Compound Name | 4-(1-chloropropyl)-1-(2-ethylhexyl)-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 55223281 |
| Molecular Formula | C16H29ClN2 |
| Molecular Weight | 284.88 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 4-(1-chloropropyl)-1-(2-ethylhexyl)-3,5-dimethylpyrazole |
| SMILES | CCCCC(CC)Cn1nc(C)c(C(Cl)CC)c1C |
| InChI | InChI=1S/C16H29ClN2/c1-6-9-10-14(7-2)11-19-13(5)16(12(4)18-19)15(17)8-3/h14-15H,6-11H2,1-5H3 |
| InChIKey | GQXCOJWQZBJODV-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.88 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|