C13H23ClN2 — CID 83168709
4-(1-chloroethyl)-3,5-dimethyl-1-(4-methylpentyl)pyrazole (PubChem CID 83168709) has the molecular formula C13H23ClN2 and a molecular weight of 242.79 g/mol. Its IUPAC name is 4-(1-chloroethyl)-3,5-dimethyl-1-(4-methylpentyl)pyrazole.
| Compound Name | 4-(1-chloroethyl)-3,5-dimethyl-1-(4-methylpentyl)pyrazole |
|---|---|
| PubChem CID | 83168709 |
| Molecular Formula | C13H23ClN2 |
| Molecular Weight | 242.79 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 4-(1-chloroethyl)-3,5-dimethyl-1-(4-methylpentyl)pyrazole |
| SMILES | Cc1nn(CCCC(C)C)c(C)c1C(C)Cl |
| InChI | InChI=1S/C13H23ClN2/c1-9(2)7-6-8-16-12(5)13(10(3)14)11(4)15-16/h9-10H,6-8H2,1-5H3 |
| InChIKey | CDNICKYBWNVRMK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.79 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|