C12H21ClN2O2S — CID 106730667
4-(1-chloroethyl)-3,5-dimethyl-1-(2-propan-2-ylsulfonylethyl)pyrazole (PubChem CID 106730667) has the molecular formula C12H21ClN2O2S and a molecular weight of 292.83 g/mol. Its IUPAC name is 4-(1-chloroethyl)-3,5-dimethyl-1-(2-propan-2-ylsulfonylethyl)pyrazole.
| Compound Name | 4-(1-chloroethyl)-3,5-dimethyl-1-(2-propan-2-ylsulfonylethyl)pyrazole |
|---|---|
| PubChem CID | 106730667 |
| Molecular Formula | C12H21ClN2O2S |
| Molecular Weight | 292.83 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 4-(1-chloroethyl)-3,5-dimethyl-1-(2-propan-2-ylsulfonylethyl)pyrazole |
| SMILES | Cc1nn(CCS(=O)(=O)C(C)C)c(C)c1C(C)Cl |
| InChI | InChI=1S/C12H21ClN2O2S/c1-8(2)18(16,17)7-6-15-11(5)12(9(3)13)10(4)14-15/h8-9H,6-7H2,1-5H3 |
| InChIKey | VSSDNYQIMHJZHS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.83 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|