C11H19ClN2O — CID 62731648
4-(1-chloroethyl)-1-(3-methoxypropyl)-3,5-dimethylpyrazole (PubChem CID 62731648) has the molecular formula C11H19ClN2O and a molecular weight of 230.74 g/mol. Its IUPAC name is 4-(1-chloroethyl)-1-(3-methoxypropyl)-3,5-dimethylpyrazole.
| Compound Name | 4-(1-chloroethyl)-1-(3-methoxypropyl)-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 62731648 |
| Molecular Formula | C11H19ClN2O |
| Molecular Weight | 230.74 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 4-(1-chloroethyl)-1-(3-methoxypropyl)-3,5-dimethylpyrazole |
| SMILES | COCCCn1nc(C)c(C(C)Cl)c1C |
| InChI | InChI=1S/C11H19ClN2O/c1-8(12)11-9(2)13-14(10(11)3)6-5-7-15-4/h8H,5-7H2,1-4H3 |
| InChIKey | NEIBNAFUQJELTH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.74 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|