C15H18ClFN2O — CID 104794815
4-(1-chloroethyl)-1-[(2-fluoro-3-methoxyphenyl)methyl]-3,5-dimethylpyrazole (PubChem CID 104794815) has the molecular formula C15H18ClFN2O and a molecular weight of 296.77 g/mol. Its IUPAC name is 4-(1-chloroethyl)-1-[(2-fluoro-3-methoxyphenyl)methyl]-3,5-dimethylpyrazole.
| Compound Name | 4-(1-chloroethyl)-1-[(2-fluoro-3-methoxyphenyl)methyl]-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 104794815 |
| Molecular Formula | C15H18ClFN2O |
| Molecular Weight | 296.77 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 4-(1-chloroethyl)-1-[(2-fluoro-3-methoxyphenyl)methyl]-3,5-dimethylpyrazole |
| SMILES | COc1cccc(Cn2nc(C)c(C(C)Cl)c2C)c1F |
| InChI | InChI=1S/C15H18ClFN2O/c1-9(16)14-10(2)18-19(11(14)3)8-12-6-5-7-13(20-4)15(12)17/h5-7,9H,8H2,1-4H3 |
| InChIKey | VLKQTAWERKIPRM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.77 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|