C16H22N2 — CID 55225246
cyclopentyl-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methanimine (PubChem CID 55225246) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is cyclopentyl-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methanimine.
| Compound Name | cyclopentyl-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methanimine |
|---|---|
| PubChem CID | 55225246 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | cyclopentyl-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methanimine |
| SMILES | [H]/N=C(\C1CCCC1)N1CC(C)Cc2ccccc21 |
| InChI | InChI=1S/C16H22N2/c1-12-10-14-8-4-5-9-15(14)18(11-12)16(17)13-6-2-3-7-13/h4-5,8-9,12-13,17H,2-3,6-7,10-11H2,1H3/b17-16+ |
| InChIKey | CKEBUSJRDKAKSZ-WUKNDPDISA-N |
| XLogP | 3.85 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|