C12H17N3 — CID 63489252
N',3-dimethyl-3,4-dihydro-2H-quinoline-1-carboximidamide (PubChem CID 63489252) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is N',3-dimethyl-3,4-dihydro-2H-quinoline-1-carboximidamide.
| Compound Name | N',3-dimethyl-3,4-dihydro-2H-quinoline-1-carboximidamide |
|---|---|
| PubChem CID | 63489252 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | N',3-dimethyl-3,4-dihydro-2H-quinoline-1-carboximidamide |
| SMILES | C/N=C(\N)N1CC(C)Cc2ccccc21 |
| InChI | InChI=1S/C12H17N3/c1-9-7-10-5-3-4-6-11(10)15(8-9)12(13)14-2/h3-6,9H,7-8H2,1-2H3,(H2,13,14) |
| InChIKey | ATWKKJKJRIISOU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|