C14H11Br2ClOS — CID 55226474
4-[chloro-(2,5-dibromothiophen-3-yl)methyl]-3,4-dihydro-2H-chromene (PubChem CID 55226474) has the molecular formula C14H11Br2ClOS and a molecular weight of 422.57 g/mol. Its IUPAC name is 4-[chloro-(2,5-dibromothiophen-3-yl)methyl]-3,4-dihydro-2H-chromene.
| Compound Name | 4-[chloro-(2,5-dibromothiophen-3-yl)methyl]-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 55226474 |
| Molecular Formula | C14H11Br2ClOS |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 419.86 |
| IUPAC Name | 4-[chloro-(2,5-dibromothiophen-3-yl)methyl]-3,4-dihydro-2H-chromene |
| SMILES | ClC(c1cc(Br)sc1Br)C1CCOc2ccccc21 |
| InChI | InChI=1S/C14H11Br2ClOS/c15-12-7-10(14(16)19-12)13(17)9-5-6-18-11-4-2-1-3-8(9)11/h1-4,7,9,13H,5-6H2 |
| InChIKey | RZDYWRDRDLSUKL-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|