C16H15Br2NO — CID 63708815
(2,5-dibromophenyl)-(3,4-dihydro-2H-chromen-4-yl)methanamine (PubChem CID 63708815) has the molecular formula C16H15Br2NO and a molecular weight of 397.11 g/mol. Its IUPAC name is (2,5-dibromophenyl)-(3,4-dihydro-2H-chromen-4-yl)methanamine.
| Compound Name | (2,5-dibromophenyl)-(3,4-dihydro-2H-chromen-4-yl)methanamine |
|---|---|
| PubChem CID | 63708815 |
| Molecular Formula | C16H15Br2NO |
| Molecular Weight | 397.11 g/mol |
| Exact Mass | 394.95 |
| IUPAC Name | (2,5-dibromophenyl)-(3,4-dihydro-2H-chromen-4-yl)methanamine |
| SMILES | NC(c1cc(Br)ccc1Br)C1CCOc2ccccc21 |
| InChI | InChI=1S/C16H15Br2NO/c17-10-5-6-14(18)13(9-10)16(19)12-7-8-20-15-4-2-1-3-11(12)15/h1-6,9,12,16H,7-8,19H2 |
| InChIKey | WXGDGTIVZKKOBD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.11 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |