C13H25NO3 — CID 55236913
(E)-4-[2-methoxyethyl(pentan-3-yl)amino]-3-methylbut-2-enoic acid (PubChem CID 55236913) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is (E)-4-[2-methoxyethyl(pentan-3-yl)amino]-3-methylbut-2-enoic acid.
| Compound Name | (E)-4-[2-methoxyethyl(pentan-3-yl)amino]-3-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 55236913 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | (E)-4-[2-methoxyethyl(pentan-3-yl)amino]-3-methylbut-2-enoic acid |
| SMILES | CCC(CC)N(CCOC)C/C(C)=C/C(=O)O |
| InChI | InChI=1S/C13H25NO3/c1-5-12(6-2)14(7-8-17-4)10-11(3)9-13(15)16/h9,12H,5-8,10H2,1-4H3,(H,15,16)/b11-9+ |
| InChIKey | PUZJIQLFTMVCMK-PKNBQFBNSA-N |
| XLogP | 2.15 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|