C14H10Cl2OS — CID 55238761
4-(2,5-dichlorophenyl)sulfanyl-3-methylbenzaldehyde (PubChem CID 55238761) has the molecular formula C14H10Cl2OS and a molecular weight of 297.21 g/mol. Its IUPAC name is 4-(2,5-dichlorophenyl)sulfanyl-3-methylbenzaldehyde.
| Compound Name | 4-(2,5-dichlorophenyl)sulfanyl-3-methylbenzaldehyde |
|---|---|
| PubChem CID | 55238761 |
| Molecular Formula | C14H10Cl2OS |
| Molecular Weight | 297.21 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | 4-(2,5-dichlorophenyl)sulfanyl-3-methylbenzaldehyde |
| SMILES | Cc1cc(C=O)ccc1Sc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H10Cl2OS/c1-9-6-10(8-17)2-5-13(9)18-14-7-11(15)3-4-12(14)16/h2-8H,1H3 |
| InChIKey | NLXSKZRSWKYTEF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.21 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|