C10H7N5 — CID 55239789
1-(1,2,4-triazol-1-yl)phthalazine (PubChem CID 55239789) has the molecular formula C10H7N5 and a molecular weight of 197.20 g/mol. Its IUPAC name is 1-(1,2,4-triazol-1-yl)phthalazine.
| Compound Name | 1-(1,2,4-triazol-1-yl)phthalazine |
|---|---|
| PubChem CID | 55239789 |
| Molecular Formula | C10H7N5 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 1-(1,2,4-triazol-1-yl)phthalazine |
| SMILES | c1ccc2c(-n3cncn3)nncc2c1 |
| InChI | InChI=1S/C10H7N5/c1-2-4-9-8(3-1)5-12-14-10(9)15-7-11-6-13-15/h1-7H |
| InChIKey | ZYVUHOKOSFHNJI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |