C11H12ClN5S — CID 55242063
2-[(2-amino-6-chlorophenyl)methylsulfanyl]pyrimidine-4,6-diamine (PubChem CID 55242063) has the molecular formula C11H12ClN5S and a molecular weight of 281.77 g/mol. Its IUPAC name is 2-[(2-amino-6-chlorophenyl)methylsulfanyl]pyrimidine-4,6-diamine.
| Compound Name | 2-[(2-amino-6-chlorophenyl)methylsulfanyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 55242063 |
| Molecular Formula | C11H12ClN5S |
| Molecular Weight | 281.77 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 2-[(2-amino-6-chlorophenyl)methylsulfanyl]pyrimidine-4,6-diamine |
| SMILES | Nc1cc(N)nc(SCc2c(N)cccc2Cl)n1 |
| InChI | InChI=1S/C11H12ClN5S/c12-7-2-1-3-8(13)6(7)5-18-11-16-9(14)4-10(15)17-11/h1-4H,5,13H2,(H4,14,15,16,17) |
| InChIKey | HIPSJRYXDINMCW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.77 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|