C10H8Cl2N4S — CID 2818557
4-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,5-triazin-2-amine (PubChem CID 2818557) has the molecular formula C10H8Cl2N4S and a molecular weight of 287.18 g/mol. Its IUPAC name is 4-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 2818557 |
| Molecular Formula | C10H8Cl2N4S |
| Molecular Weight | 287.18 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 4-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,5-triazin-2-amine |
| SMILES | Nc1ncnc(SCc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C10H8Cl2N4S/c11-7-2-1-3-8(12)6(7)4-17-10-15-5-14-9(13)16-10/h1-3,5H,4H2,(H2,13,14,15,16) |
| InChIKey | ADCUKLIHSHGORF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.18 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |