C13H22N2O2 — CID 55247242
2,2-diethoxy-N-methyl-N-(pyridin-3-ylmethyl)ethanamine (PubChem CID 55247242) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2,2-diethoxy-N-methyl-N-(pyridin-3-ylmethyl)ethanamine.
| Compound Name | 2,2-diethoxy-N-methyl-N-(pyridin-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 55247242 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 2,2-diethoxy-N-methyl-N-(pyridin-3-ylmethyl)ethanamine |
| SMILES | CCOC(CN(C)Cc1cccnc1)OCC |
| InChI | InChI=1S/C13H22N2O2/c1-4-16-13(17-5-2)11-15(3)10-12-7-6-8-14-9-12/h6-9,13H,4-5,10-11H2,1-3H3 |
| InChIKey | NGKBTFJFDGCMCM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|