C13H12N2O3S — CID 55247579
6-[(3-ethylthiophene-2-carbonyl)amino]pyridine-2-carboxylic acid (PubChem CID 55247579) has the molecular formula C13H12N2O3S and a molecular weight of 276.32 g/mol. Its IUPAC name is 6-[(3-ethylthiophene-2-carbonyl)amino]pyridine-2-carboxylic acid.
| Compound Name | 6-[(3-ethylthiophene-2-carbonyl)amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 55247579 |
| Molecular Formula | C13H12N2O3S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 6-[(3-ethylthiophene-2-carbonyl)amino]pyridine-2-carboxylic acid |
| SMILES | CCc1ccsc1C(=O)Nc1cccc(C(=O)O)n1 |
| InChI | InChI=1S/C13H12N2O3S/c1-2-8-6-7-19-11(8)12(16)15-10-5-3-4-9(14-10)13(17)18/h3-7H,2H2,1H3,(H,17,18)(H,14,15,16) |
| InChIKey | YXDDVGWXRZIZHY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |