C11H10ClNO4 — CID 55250200
4-chloro-5,6-dimethoxy-1H-indole-2-carboxylic acid (PubChem CID 55250200) has the molecular formula C11H10ClNO4 and a molecular weight of 255.66 g/mol. Its IUPAC name is 4-chloro-5,6-dimethoxy-1H-indole-2-carboxylic acid.
| Compound Name | 4-chloro-5,6-dimethoxy-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 55250200 |
| Molecular Formula | C11H10ClNO4 |
| Molecular Weight | 255.66 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 4-chloro-5,6-dimethoxy-1H-indole-2-carboxylic acid |
| SMILES | COc1cc2[nH]c(C(=O)O)cc2c(Cl)c1OC |
| InChI | InChI=1S/C11H10ClNO4/c1-16-8-4-6-5(9(12)10(8)17-2)3-7(13-6)11(14)15/h3-4,13H,1-2H3,(H,14,15) |
| InChIKey | SJBLEWRRGPWSDC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.66 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |