4-chloro-5,6-dimethoxy-1H-indole-2-carboxylic acid

C11H10ClNO4 — CID 55250200

IUPAC4-chloro-5,6-dimethoxy-1H-indole-2-carboxylic acid
SMILESCOc1cc2[nH]c(C(=O)O)cc2c(Cl)c1OC
InChIInChI=1S/C11H10ClNO4/c1-16-8-4-6-5(9(12)10(8)17-2)3-7(13-6)11(14)15/h3-4,13H,1-2H3,(H,14,15)
InChIKeySJBLEWRRGPWSDC-UHFFFAOYSA-N
MW255.66 g/mol
LogP2.54
Rot. Bonds3

About 4-chloro-5,6-dimethoxy-1H-indole-2-carboxylic acid

4-chloro-5,6-dimethoxy-1H-indole-2-carboxylic acid (PubChem CID 55250200) has the molecular formula C11H10ClNO4 and a molecular weight of 255.66 g/mol. Its IUPAC name is 4-chloro-5,6-dimethoxy-1H-indole-2-carboxylic acid.

Molecular Properties

Compound Name4-chloro-5,6-dimethoxy-1H-indole-2-carboxylic acid
PubChem CID55250200
Molecular FormulaC11H10ClNO4
Molecular Weight255.66 g/mol
Exact Mass255.03
IUPAC Name4-chloro-5,6-dimethoxy-1H-indole-2-carboxylic acid
SMILESCOc1cc2[nH]c(C(=O)O)cc2c(Cl)c1OC
InChIInChI=1S/C11H10ClNO4/c1-16-8-4-6-5(9(12)10(8)17-2)3-7(13-6)11(14)15/h3-4,13H,1-2H3,(H,14,15)
InChIKeySJBLEWRRGPWSDC-UHFFFAOYSA-N
XLogP2.54
TPSA71.55 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.66
LogP ≤ 52.54
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-chloro-5,6-dimethoxy-1H-indole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-chloro-5,6-dimethoxy-1H-indole-2-carboxylic acid?
The IUPAC name of 4-chloro-5,6-dimethoxy-1H-indole-2-carboxylic acid (CID 55250200) is 4-chloro-5,6-dimethoxy-1H-indole-2-carboxylic acid.
What is the SMILES notation for 4-chloro-5,6-dimethoxy-1H-indole-2-carboxylic acid?
The canonical SMILES for 4-chloro-5,6-dimethoxy-1H-indole-2-carboxylic acid is COc1cc2[nH]c(C(=O)O)cc2c(Cl)c1OC.
What is the InChIKey of 4-chloro-5,6-dimethoxy-1H-indole-2-carboxylic acid?
The InChIKey is SJBLEWRRGPWSDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClNO4/c1-16-8-4-6-5(9(12)10(8)17-2)3-7(13-6)11(14)15/h3-4,13H,1-2H3,(H,14,15).
What are the key properties of 4-chloro-5,6-dimethoxy-1H-indole-2-carboxylic acid?
4-chloro-5,6-dimethoxy-1H-indole-2-carboxylic acid has a molecular weight of 255.66 g/mol, XLogP of 2.54, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5,6-dimethoxy-1H-indole-2-carboxylic acid is sourced from PubChem (CID 55250200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).