C15H15NO7 — CID 24881648
3-(3,4,5-trimethoxyphenyl)-1H-pyrrole-2,5-dicarboxylic acid (PubChem CID 24881648) has the molecular formula C15H15NO7 and a molecular weight of 321.29 g/mol. Its IUPAC name is 3-(3,4,5-trimethoxyphenyl)-1H-pyrrole-2,5-dicarboxylic acid.
| Compound Name | 3-(3,4,5-trimethoxyphenyl)-1H-pyrrole-2,5-dicarboxylic acid |
|---|---|
| PubChem CID | 24881648 |
| Molecular Formula | C15H15NO7 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 3-(3,4,5-trimethoxyphenyl)-1H-pyrrole-2,5-dicarboxylic acid |
| SMILES | COc1cc(-c2cc(C(=O)O)[nH]c2C(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C15H15NO7/c1-21-10-4-7(5-11(22-2)13(10)23-3)8-6-9(14(17)18)16-12(8)15(19)20/h4-6,16H,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | YWUZKBMTWWMMJC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |