C9H14N2O — CID 55253392
(1-methyl-4,5,6,7-tetrahydroindazol-5-yl)methanol (PubChem CID 55253392) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is (1-methyl-4,5,6,7-tetrahydroindazol-5-yl)methanol.
| Compound Name | (1-methyl-4,5,6,7-tetrahydroindazol-5-yl)methanol |
|---|---|
| PubChem CID | 55253392 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | (1-methyl-4,5,6,7-tetrahydroindazol-5-yl)methanol |
| SMILES | Cn1ncc2c1CCC(CO)C2 |
| InChI | InChI=1S/C9H14N2O/c1-11-9-3-2-7(6-12)4-8(9)5-10-11/h5,7,12H,2-4,6H2,1H3 |
| InChIKey | IXLOOBUXHDGAEE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |