methyl 4-(2-aminoethyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate

C10H16N2O2 — CID 55254534

IUPACmethyl 4-(2-aminoethyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate
SMILESCOC(=O)c1c(C)[nH]c(C)c1CCN
InChIInChI=1S/C10H16N2O2/c1-6-8(4-5-11)9(7(2)12-6)10(13)14-3/h12H,4-5,11H2,1-3H3
InChIKeyCUNMLJRHZHXVQD-UHFFFAOYSA-N
MW196.25 g/mol
LogP0.92
Rot. Bonds3

About methyl 4-(2-aminoethyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate

methyl 4-(2-aminoethyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 55254534) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is methyl 4-(2-aminoethyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate.

Molecular Properties

Compound Namemethyl 4-(2-aminoethyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate
PubChem CID55254534
Molecular FormulaC10H16N2O2
Molecular Weight196.25 g/mol
Exact Mass196.12
IUPAC Namemethyl 4-(2-aminoethyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate
SMILESCOC(=O)c1c(C)[nH]c(C)c1CCN
InChIInChI=1S/C10H16N2O2/c1-6-8(4-5-11)9(7(2)12-6)10(13)14-3/h12H,4-5,11H2,1-3H3
InChIKeyCUNMLJRHZHXVQD-UHFFFAOYSA-N
XLogP0.92
TPSA68.11 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.25
LogP ≤ 50.92
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze methyl 4-(2-aminoethyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(2-aminoethyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate?
The IUPAC name of methyl 4-(2-aminoethyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate (CID 55254534) is methyl 4-(2-aminoethyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate.
What is the SMILES notation for methyl 4-(2-aminoethyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate?
The canonical SMILES for methyl 4-(2-aminoethyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate is COC(=O)c1c(C)[nH]c(C)c1CCN.
What is the InChIKey of methyl 4-(2-aminoethyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate?
The InChIKey is CUNMLJRHZHXVQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-6-8(4-5-11)9(7(2)12-6)10(13)14-3/h12H,4-5,11H2,1-3H3.
What are the key properties of methyl 4-(2-aminoethyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate?
methyl 4-(2-aminoethyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate has a molecular weight of 196.25 g/mol, XLogP of 0.92, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2-aminoethyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate is sourced from PubChem (CID 55254534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).