C16H26N2O — CID 55259550
N-(6-amino-2,3-dimethylphenyl)-3,4,4-trimethylpentanamide (PubChem CID 55259550) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is N-(6-amino-2,3-dimethylphenyl)-3,4,4-trimethylpentanamide.
| Compound Name | N-(6-amino-2,3-dimethylphenyl)-3,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 55259550 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | N-(6-amino-2,3-dimethylphenyl)-3,4,4-trimethylpentanamide |
| SMILES | Cc1ccc(N)c(NC(=O)CC(C)C(C)(C)C)c1C |
| InChI | InChI=1S/C16H26N2O/c1-10-7-8-13(17)15(12(10)3)18-14(19)9-11(2)16(4,5)6/h7-8,11H,9,17H2,1-6H3,(H,18,19) |
| InChIKey | XWTDPBDNAKTQHE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|