C12H17NO — CID 55265069
3,3-dimethyl-1-(4-methyl-2-pyridinyl)butan-1-one (PubChem CID 55265069) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 3,3-dimethyl-1-(4-methyl-2-pyridinyl)butan-1-one.
| Compound Name | 3,3-dimethyl-1-(4-methyl-2-pyridinyl)butan-1-one |
|---|---|
| PubChem CID | 55265069 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 3,3-dimethyl-1-(4-methyl-2-pyridinyl)butan-1-one |
| SMILES | Cc1ccnc(C(=O)CC(C)(C)C)c1 |
| InChI | InChI=1S/C12H17NO/c1-9-5-6-13-10(7-9)11(14)8-12(2,3)4/h5-7H,8H2,1-4H3 |
| InChIKey | AETMLCQUXDEBFZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |