C11H10N2OS — CID 79823558
1-(4-methyl-2-pyridinyl)-2-(1,3-thiazol-2-yl)ethanone (PubChem CID 79823558) has the molecular formula C11H10N2OS and a molecular weight of 218.28 g/mol. Its IUPAC name is 1-(4-methyl-2-pyridinyl)-2-(1,3-thiazol-2-yl)ethanone.
| Compound Name | 1-(4-methyl-2-pyridinyl)-2-(1,3-thiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 79823558 |
| Molecular Formula | C11H10N2OS |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 1-(4-methyl-2-pyridinyl)-2-(1,3-thiazol-2-yl)ethanone |
| SMILES | Cc1ccnc(C(=O)Cc2nccs2)c1 |
| InChI | InChI=1S/C11H10N2OS/c1-8-2-3-12-9(6-8)10(14)7-11-13-4-5-15-11/h2-6H,7H2,1H3 |
| InChIKey | LVNKDBRLBNHSSG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |