About 1-(1-methylpyrazol-3-yl)-2-(1,3-thiazol-2-yl)ethanone
1-(1-methylpyrazol-3-yl)-2-(1,3-thiazol-2-yl)ethanone (PubChem CID 79825110) has the molecular formula C9H9N3OS
and a molecular weight of 207.26 g/mol. Its IUPAC name is 1-(1-methylpyrazol-3-yl)-2-(1,3-thiazol-2-yl)ethanone.
Analyze 1-(1-methylpyrazol-3-yl)-2-(1,3-thiazol-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methylpyrazol-3-yl)-2-(1,3-thiazol-2-yl)ethanone?
The IUPAC name of 1-(1-methylpyrazol-3-yl)-2-(1,3-thiazol-2-yl)ethanone (CID 79825110) is 1-(1-methylpyrazol-3-yl)-2-(1,3-thiazol-2-yl)ethanone.
What is the SMILES notation for 1-(1-methylpyrazol-3-yl)-2-(1,3-thiazol-2-yl)ethanone?
The canonical SMILES for 1-(1-methylpyrazol-3-yl)-2-(1,3-thiazol-2-yl)ethanone is Cn1ccc(C(=O)Cc2nccs2)n1.
What is the InChIKey of 1-(1-methylpyrazol-3-yl)-2-(1,3-thiazol-2-yl)ethanone?
The InChIKey is LEXZYBCHNDCTTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3OS/c1-12-4-2-7(11-12)8(13)6-9-10-3-5-14-9/h2-5H,6H2,1H3.
What are the key properties of 1-(1-methylpyrazol-3-yl)-2-(1,3-thiazol-2-yl)ethanone?
1-(1-methylpyrazol-3-yl)-2-(1,3-thiazol-2-yl)ethanone has a molecular weight of 207.26 g/mol, XLogP of 1.30, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methylpyrazol-3-yl)-2-(1,3-thiazol-2-yl)ethanone is sourced from PubChem (CID 79825110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).