About ethyl 3-phenoxypropanimidate
ethyl 3-phenoxypropanimidate (PubChem CID 55267889) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is ethyl 3-phenoxypropanimidate.
Molecular Properties
| Compound Name | ethyl 3-phenoxypropanimidate |
| PubChem CID | 55267889 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | ethyl 3-phenoxypropanimidate |
| SMILES | [H]/N=C(/CCOc1ccccc1)OCC |
| InChI | InChI=1S/C11H15NO2/c1-2-13-11(12)8-9-14-10-6-4-3-5-7-10/h3-7,12H,2,8-9H2,1H3/b12-11- |
| InChIKey | DZRYWQFZIJGFFS-QXMHVHEDSA-N |
| XLogP | 2.47 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-phenoxypropanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-phenoxypropanimidate?
The IUPAC name of ethyl 3-phenoxypropanimidate (CID 55267889) is ethyl 3-phenoxypropanimidate.
What is the SMILES notation for ethyl 3-phenoxypropanimidate?
The canonical SMILES for ethyl 3-phenoxypropanimidate is [H]/N=C(/CCOc1ccccc1)OCC.
What is the InChIKey of ethyl 3-phenoxypropanimidate?
The InChIKey is DZRYWQFZIJGFFS-QXMHVHEDSA-N. The full InChI is InChI=1S/C11H15NO2/c1-2-13-11(12)8-9-14-10-6-4-3-5-7-10/h3-7,12H,2,8-9H2,1H3/b12-11-.
What are the key properties of ethyl 3-phenoxypropanimidate?
ethyl 3-phenoxypropanimidate has a molecular weight of 193.25 g/mol, XLogP of 2.47, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-phenoxypropanimidate is sourced from PubChem (CID 55267889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).