C10H10N2O2 — CID 55272287
2-amino-2-[3-(cyanomethyl)phenyl]acetic acid (PubChem CID 55272287) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 2-amino-2-[3-(cyanomethyl)phenyl]acetic acid.
| Compound Name | 2-amino-2-[3-(cyanomethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 55272287 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 2-amino-2-[3-(cyanomethyl)phenyl]acetic acid |
| SMILES | N#CCc1cccc(C(N)C(=O)O)c1 |
| InChI | InChI=1S/C10H10N2O2/c11-5-4-7-2-1-3-8(6-7)9(12)10(13)14/h1-3,6,9H,4,12H2,(H,13,14) |
| InChIKey | DVINBOICUUKRFV-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |