C4H7N3S — CID 55274611
N,4-dimethylthiadiazol-5-amine (PubChem CID 55274611) has the molecular formula C4H7N3S and a molecular weight of 129.19 g/mol. Its IUPAC name is N,4-dimethylthiadiazol-5-amine.
| Compound Name | N,4-dimethylthiadiazol-5-amine |
|---|---|
| PubChem CID | 55274611 |
| Molecular Formula | C4H7N3S |
| Molecular Weight | 129.19 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | N,4-dimethylthiadiazol-5-amine |
| SMILES | CNc1snnc1C |
| InChI | InChI=1S/C4H7N3S/c1-3-4(5-2)8-7-6-3/h5H,1-2H3 |
| InChIKey | KLAAXRGKCHFYTK-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.19 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |