C9H18N4S — CID 62182547
4-[[ethyl(propyl)amino]methyl]-N-methylthiadiazol-5-amine (PubChem CID 62182547) has the molecular formula C9H18N4S and a molecular weight of 214.34 g/mol. Its IUPAC name is 4-[[ethyl(propyl)amino]methyl]-N-methylthiadiazol-5-amine.
| Compound Name | 4-[[ethyl(propyl)amino]methyl]-N-methylthiadiazol-5-amine |
|---|---|
| PubChem CID | 62182547 |
| Molecular Formula | C9H18N4S |
| Molecular Weight | 214.34 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 4-[[ethyl(propyl)amino]methyl]-N-methylthiadiazol-5-amine |
| SMILES | CCCN(CC)Cc1nnsc1NC |
| InChI | InChI=1S/C9H18N4S/c1-4-6-13(5-2)7-8-9(10-3)14-12-11-8/h10H,4-7H2,1-3H3 |
| InChIKey | CSPZYEPSZDPYIV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |