C9H16N2 — CID 55275919
(1R)-1-(1,2,5-trimethylpyrrol-3-yl)ethanamine (PubChem CID 55275919) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (1R)-1-(1,2,5-trimethylpyrrol-3-yl)ethanamine.
| Compound Name | (1R)-1-(1,2,5-trimethylpyrrol-3-yl)ethanamine |
|---|---|
| PubChem CID | 55275919 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (1R)-1-(1,2,5-trimethylpyrrol-3-yl)ethanamine |
| SMILES | Cc1cc([C@@H](C)N)c(C)n1C |
| InChI | InChI=1S/C9H16N2/c1-6-5-9(7(2)10)8(3)11(6)4/h5,7H,10H2,1-4H3/t7-/m1/s1 |
| InChIKey | LEPQIHYOFFBGNG-SSDOTTSWSA-N |
| XLogP | 1.66 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |