C9H13NO4 — CID 55276777
5-[(1S)-2-hydroxy-1-(methylamino)ethyl]benzene-1,2,3-triol (PubChem CID 55276777) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is 5-[(1S)-2-hydroxy-1-(methylamino)ethyl]benzene-1,2,3-triol.
| Compound Name | 5-[(1S)-2-hydroxy-1-(methylamino)ethyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 55276777 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 5-[(1S)-2-hydroxy-1-(methylamino)ethyl]benzene-1,2,3-triol |
| SMILES | CN[C@H](CO)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C9H13NO4/c1-10-6(4-11)5-2-7(12)9(14)8(13)3-5/h2-3,6,10-14H,4H2,1H3/t6-/m1/s1 |
| InChIKey | JNVHNGDWYWBXTI-ZCFIWIBFSA-N |
| XLogP | 0.06 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|