C10H17ClO2S — CID 55279558
(2R)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-sulfonyl chloride (PubChem CID 55279558) has the molecular formula C10H17ClO2S and a molecular weight of 236.76 g/mol. Its IUPAC name is (2R)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-sulfonyl chloride.
| Compound Name | (2R)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-sulfonyl chloride |
|---|---|
| PubChem CID | 55279558 |
| Molecular Formula | C10H17ClO2S |
| Molecular Weight | 236.76 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | (2R)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)[C@@H]1CCC2CCCCC2C1 |
| InChI | InChI=1S/C10H17ClO2S/c11-14(12,13)10-6-5-8-3-1-2-4-9(8)7-10/h8-10H,1-7H2/t8?,9?,10-/m1/s1 |
| InChIKey | AFKIBSLYCRGOMI-UDNWOFFPSA-N |
| XLogP | 2.91 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.76 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |