methyl 5-chlorosulfonylpyridine-2-carboxylate

C7H6ClNO4S — CID 55279599

IUPACmethyl 5-chlorosulfonylpyridine-2-carboxylate
SMILESCOC(=O)c1ccc(S(=O)(=O)Cl)cn1
InChIInChI=1S/C7H6ClNO4S/c1-13-7(10)6-3-2-5(4-9-6)14(8,11)12/h2-4H,1H3
InChIKeyKNWRLXXUWDOFIN-UHFFFAOYSA-N
MW235.65 g/mol
LogP0.80
Rot. Bonds2

About methyl 5-chlorosulfonylpyridine-2-carboxylate

methyl 5-chlorosulfonylpyridine-2-carboxylate (PubChem CID 55279599) has the molecular formula C7H6ClNO4S and a molecular weight of 235.65 g/mol. Its IUPAC name is methyl 5-chlorosulfonylpyridine-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-chlorosulfonylpyridine-2-carboxylate
PubChem CID55279599
Molecular FormulaC7H6ClNO4S
Molecular Weight235.65 g/mol
Exact Mass234.97
IUPAC Namemethyl 5-chlorosulfonylpyridine-2-carboxylate
SMILESCOC(=O)c1ccc(S(=O)(=O)Cl)cn1
InChIInChI=1S/C7H6ClNO4S/c1-13-7(10)6-3-2-5(4-9-6)14(8,11)12/h2-4H,1H3
InChIKeyKNWRLXXUWDOFIN-UHFFFAOYSA-N
XLogP0.80
TPSA73.33 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.65
LogP ≤ 50.80
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 5-chlorosulfonylpyridine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-chlorosulfonylpyridine-2-carboxylate?
The IUPAC name of methyl 5-chlorosulfonylpyridine-2-carboxylate (CID 55279599) is methyl 5-chlorosulfonylpyridine-2-carboxylate.
What is the SMILES notation for methyl 5-chlorosulfonylpyridine-2-carboxylate?
The canonical SMILES for methyl 5-chlorosulfonylpyridine-2-carboxylate is COC(=O)c1ccc(S(=O)(=O)Cl)cn1.
What is the InChIKey of methyl 5-chlorosulfonylpyridine-2-carboxylate?
The InChIKey is KNWRLXXUWDOFIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClNO4S/c1-13-7(10)6-3-2-5(4-9-6)14(8,11)12/h2-4H,1H3.
What are the key properties of methyl 5-chlorosulfonylpyridine-2-carboxylate?
methyl 5-chlorosulfonylpyridine-2-carboxylate has a molecular weight of 235.65 g/mol, XLogP of 0.80, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-chlorosulfonylpyridine-2-carboxylate is sourced from PubChem (CID 55279599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).