C8H13ClO2S — CID 55280024
3,4-dimethylcyclohex-3-ene-1-sulfonyl chloride (PubChem CID 55280024) has the molecular formula C8H13ClO2S and a molecular weight of 208.71 g/mol. Its IUPAC name is 3,4-dimethylcyclohex-3-ene-1-sulfonyl chloride.
| Compound Name | 3,4-dimethylcyclohex-3-ene-1-sulfonyl chloride |
|---|---|
| PubChem CID | 55280024 |
| Molecular Formula | C8H13ClO2S |
| Molecular Weight | 208.71 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 3,4-dimethylcyclohex-3-ene-1-sulfonyl chloride |
| SMILES | CC1=C(C)CC(S(=O)(=O)Cl)CC1 |
| InChI | InChI=1S/C8H13ClO2S/c1-6-3-4-8(5-7(6)2)12(9,10)11/h8H,3-5H2,1-2H3 |
| InChIKey | XPALHSKSKCJRBO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.71 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|